C32H24F2N8O4S2 — CID 153382327
4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]naphthalene-1-sulfonamide (PubChem CID 153382327) has the molecular formula C32H24F2N8O4S2 and a molecular weight of 686.73 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]naphthalene-1-sulfonamide.
| Compound Name | 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 153382327 |
| Molecular Formula | C32H24F2N8O4S2 |
| Molecular Weight | 686.73 g/mol |
| Exact Mass | 686.13 |
| IUPAC Name | 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-fluorophenyl]-2-fluorophenyl]diazenyl]naphthalene-1-sulfonamide |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4cc(S(N)(=O)=O)c5ccccc5c4N)c(F)c3)cc2F)cc(S(N)(=O)=O)c2ccccc12 |
| InChI | InChI=1S/C32H24F2N8O4S2/c33-23-13-17(9-11-25(23)39-41-27-15-29(47(37,43)44)19-5-1-3-7-21(19)31(27)35)18-10-12-26(24(34)14-18)40-42-28-16-30(48(38,45)46)20-6-2-4-8-22(20)32(28)36/h1-16H,35-36H2,(H2,37,43,44)(H2,38,45,46)/b41-39+,42-40+ |
| InChIKey | BRXBZWCVHWMKGB-LMXNTIJMSA-N |
| XLogP | 7.23 |
| TPSA | 221.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|