C34H24F6N8O6S2 — CID 162614417
4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-(trifluoromethoxy)phenyl]diazenyl]naphthalene-1-sulfonamide (PubChem CID 162614417) has the molecular formula C34H24F6N8O6S2 and a molecular weight of 818.74 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-(trifluoromethoxy)phenyl]diazenyl]naphthalene-1-sulfonamide.
| Compound Name | 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-(trifluoromethoxy)phenyl]diazenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 162614417 |
| Molecular Formula | C34H24F6N8O6S2 |
| Molecular Weight | 818.74 g/mol |
| Exact Mass | 818.12 |
| IUPAC Name | 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3-(trifluoromethoxy)phenyl]-2-(trifluoromethoxy)phenyl]diazenyl]naphthalene-1-sulfonamide |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4cc(S(N)(=O)=O)c5ccccc5c4N)c(OC(F)(F)F)c3)cc2OC(F)(F)F)cc(S(N)(=O)=O)c2ccccc12 |
| InChI | InChI=1S/C34H24F6N8O6S2/c35-33(36,37)53-27-13-17(9-11-23(27)45-47-25-15-29(55(43,49)50)19-5-1-3-7-21(19)31(25)41)18-10-12-24(28(14-18)54-34(38,39)40)46-48-26-16-30(56(44,51)52)20-6-2-4-8-22(20)32(26)42/h1-16H,41-42H2,(H2,43,49,50)(H2,44,51,52)/b47-45+,48-46+ |
| InChIKey | BBPXVSCMWDOPAR-MLGMXDONSA-N |
| XLogP | 8.75 |
| TPSA | 240.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.74 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|