C32H22Cl4N8O4S2 — CID 153382297
4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3,5-dichlorophenyl]-2,6-dichlorophenyl]diazenyl]naphthalene-1-sulfonamide (PubChem CID 153382297) has the molecular formula C32H22Cl4N8O4S2 and a molecular weight of 788.53 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3,5-dichlorophenyl]-2,6-dichlorophenyl]diazenyl]naphthalene-1-sulfonamide.
| Compound Name | 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3,5-dichlorophenyl]-2,6-dichlorophenyl]diazenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 153382297 |
| Molecular Formula | C32H22Cl4N8O4S2 |
| Molecular Weight | 788.53 g/mol |
| Exact Mass | 786.00 |
| IUPAC Name | 4-amino-3-[[4-[4-[(1-amino-4-sulfamoylnaphthalen-2-yl)diazenyl]-3,5-dichlorophenyl]-2,6-dichlorophenyl]diazenyl]naphthalene-1-sulfonamide |
| SMILES | Nc1c(/N=N/c2c(Cl)cc(-c3cc(Cl)c(/N=N/c4cc(S(N)(=O)=O)c5ccccc5c4N)c(Cl)c3)cc2Cl)cc(S(N)(=O)=O)c2ccccc12 |
| InChI | InChI=1S/C32H22Cl4N8O4S2/c33-21-9-15(10-22(34)31(21)43-41-25-13-27(49(39,45)46)17-5-1-3-7-19(17)29(25)37)16-11-23(35)32(24(36)12-16)44-42-26-14-28(50(40,47)48)18-6-2-4-8-20(18)30(26)38/h1-14H,37-38H2,(H2,39,45,46)(H2,40,47,48)/b43-41+,44-42+ |
| InChIKey | VODHSFVCKLXSTK-CHQNLTHESA-N |
| XLogP | 9.56 |
| TPSA | 221.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.53 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|