C24H19N3O3S — CID 102244456
4-amino-3-[[4-[(E)-2-phenylethenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 102244456) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-amino-3-[[4-[(E)-2-phenylethenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[(E)-2-phenylethenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 102244456 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 4-amino-3-[[4-[(E)-2-phenylethenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(/C=C/c3ccccc3)cc2)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C24H19N3O3S/c25-24-21-9-5-4-8-20(21)23(31(28,29)30)16-22(24)27-26-19-14-12-18(13-15-19)11-10-17-6-2-1-3-7-17/h1-16H,25H2,(H,28,29,30)/b11-10+,27-26+ |
| InChIKey | FYRZDKCJPKQYKF-TUCLXVEESA-N |
| XLogP | 6.25 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|