C34H32N6O6S2 — CID 142925572
4-amino-3-[[4-[4-[[(E)-1-[2-(aminomethyl)phenyl]-1-sulfopent-1-en-3-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 142925572) has the molecular formula C34H32N6O6S2 and a molecular weight of 684.80 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[[(E)-1-[2-(aminomethyl)phenyl]-1-sulfopent-1-en-3-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[[(E)-1-[2-(aminomethyl)phenyl]-1-sulfopent-1-en-3-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 142925572 |
| Molecular Formula | C34H32N6O6S2 |
| Molecular Weight | 684.80 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 4-amino-3-[[4-[4-[[(E)-1-[2-(aminomethyl)phenyl]-1-sulfopent-1-en-3-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | CCC(/C=C(\c1ccccc1CN)S(=O)(=O)O)/N=N/c1ccc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3N)cc2)cc1 |
| InChI | InChI=1S/C34H32N6O6S2/c1-2-25(19-32(47(41,42)43)28-8-4-3-7-24(28)21-35)37-38-26-15-11-22(12-16-26)23-13-17-27(18-14-23)39-40-31-20-33(48(44,45)46)29-9-5-6-10-30(29)34(31)36/h3-20,25H,2,21,35-36H2,1H3,(H,41,42,43)(H,44,45,46)/b32-19+,38-37+,40-39+ |
| InChIKey | KOTCONDALMJITL-PSSNCJATSA-N |
| XLogP | 8.00 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.80 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|