C26H24N4O5S — CID 158028622
4-amino-3-[[6-(3-formyl-5-methyl-4-propan-2-yloxyphenyl)-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 158028622) has the molecular formula C26H24N4O5S and a molecular weight of 504.57 g/mol. Its IUPAC name is 4-amino-3-[[6-(3-formyl-5-methyl-4-propan-2-yloxyphenyl)-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-amino-3-[[6-(3-formyl-5-methyl-4-propan-2-yloxyphenyl)-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 158028622 |
| Molecular Formula | C26H24N4O5S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 4-amino-3-[[6-(3-formyl-5-methyl-4-propan-2-yloxyphenyl)-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3N)cn2)cc(C=O)c1OC(C)C |
| InChI | InChI=1S/C26H24N4O5S/c1-15(2)35-26-16(3)10-17(11-18(26)14-31)22-9-8-19(13-28-22)29-30-23-12-24(36(32,33)34)20-6-4-5-7-21(20)25(23)27/h4-15H,27H2,1-3H3,(H,32,33,34)/b30-29+ |
| InChIKey | FGXGQBHXOFHZFR-QVIHXGFCSA-N |
| XLogP | 6.05 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|