C17H14N3O3S- — CID 139208472
4-amino-3-[(2-methylphenyl)diazenyl]naphthalene-1-sulfonate (PubChem CID 139208472) has the molecular formula C17H14N3O3S- and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-amino-3-[(2-methylphenyl)diazenyl]naphthalene-1-sulfonate.
| Compound Name | 4-amino-3-[(2-methylphenyl)diazenyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 139208472 |
| Molecular Formula | C17H14N3O3S- |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-amino-3-[(2-methylphenyl)diazenyl]naphthalene-1-sulfonate |
| SMILES | Cc1ccccc1/N=N/c1cc(S(=O)(=O)[O-])c2ccccc2c1N |
| InChI | InChI=1S/C17H15N3O3S/c1-11-6-2-5-9-14(11)19-20-15-10-16(24(21,22)23)12-7-3-4-8-13(12)17(15)18/h2-10H,18H2,1H3,(H,21,22,23)/p-1/b20-19+ |
| InChIKey | PIWJSAOBFMHEAW-FMQUCBEESA-M |
| XLogP | 4.05 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|