C14H17O3S- — CID 54368356
3,5-dimethylnaphthalene-1-sulfonate;ethane (PubChem CID 54368356) has the molecular formula C14H17O3S- and a molecular weight of 265.35 g/mol. Its IUPAC name is 3,5-dimethylnaphthalene-1-sulfonate;ethane.
| Compound Name | 3,5-dimethylnaphthalene-1-sulfonate;ethane |
|---|---|
| PubChem CID | 54368356 |
| Molecular Formula | C14H17O3S- |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3,5-dimethylnaphthalene-1-sulfonate;ethane |
| SMILES | CC.Cc1cc(S(=O)(=O)[O-])c2cccc(C)c2c1 |
| InChI | InChI=1S/C12H12O3S.C2H6/c1-8-6-11-9(2)4-3-5-10(11)12(7-8)16(13,14)15;1-2/h3-7H,1-2H3,(H,13,14,15);1-2H3/p-1 |
| InChIKey | URJJCPZNIVJBMQ-UHFFFAOYSA-M |
| XLogP | 3.39 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|