C8H8K2O6S2 — CID 102504104
dipotassium;2,5-dimethylbenzene-1,3-disulfonate (PubChem CID 102504104) has the molecular formula C8H8K2O6S2 and a molecular weight of 342.48 g/mol. Its IUPAC name is dipotassium;2,5-dimethylbenzene-1,3-disulfonate.
| Compound Name | dipotassium;2,5-dimethylbenzene-1,3-disulfonate |
|---|---|
| PubChem CID | 102504104 |
| Molecular Formula | C8H8K2O6S2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 341.90 |
| IUPAC Name | dipotassium;2,5-dimethylbenzene-1,3-disulfonate |
| SMILES | Cc1cc(S(=O)(=O)[O-])c(C)c(S(=O)(=O)[O-])c1.[K+].[K+] |
| InChI | InChI=1S/C8H10O6S2.2K/c1-5-3-7(15(9,10)11)6(2)8(4-5)16(12,13)14;;/h3-4H,1-2H3,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2 |
| InChIKey | RLCRJVGYARFWDB-UHFFFAOYSA-L |
| XLogP | -5.88 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | -5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|