C11H8O6S2-2 — CID 58611257
3-methylnaphthalene-1,5-disulfonate (PubChem CID 58611257) has the molecular formula C11H8O6S2-2 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-methylnaphthalene-1,5-disulfonate.
| Compound Name | 3-methylnaphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 58611257 |
| Molecular Formula | C11H8O6S2-2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 3-methylnaphthalene-1,5-disulfonate |
| SMILES | Cc1cc(S(=O)(=O)[O-])c2cccc(S(=O)(=O)[O-])c2c1 |
| InChI | InChI=1S/C11H10O6S2/c1-7-5-9-8(11(6-7)19(15,16)17)3-2-4-10(9)18(12,13)14/h2-6H,1H3,(H,12,13,14)(H,15,16,17)/p-2 |
| InChIKey | IDBURVRWKRXWBQ-UHFFFAOYSA-L |
| XLogP | 0.96 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|