C10H5NO8S2-2 — CID 56772282
3-nitronaphthalene-1,5-disulfonate (PubChem CID 56772282) has the molecular formula C10H5NO8S2-2 and a molecular weight of 331.28 g/mol. Its IUPAC name is 3-nitronaphthalene-1,5-disulfonate.
| Compound Name | 3-nitronaphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 56772282 |
| Molecular Formula | C10H5NO8S2-2 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 3-nitronaphthalene-1,5-disulfonate |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)[O-])c2cccc(S(=O)(=O)[O-])c2c1 |
| InChI | InChI=1S/C10H7NO8S2/c12-11(13)6-4-8-7(10(5-6)21(17,18)19)2-1-3-9(8)20(14,15)16/h1-5H,(H,14,15,16)(H,17,18,19)/p-2 |
| InChIKey | YDPFPDNDNZUKPL-UHFFFAOYSA-L |
| XLogP | 0.56 |
| TPSA | 157.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|