C10H6NNaO6S — CID 2749239
sodium 3-hydroxy-7-nitronaphthalene-1-sulfonate (PubChem CID 2749239) has the molecular formula C10H6NNaO6S and a molecular weight of 291.22 g/mol. Its IUPAC name is sodium 3-hydroxy-7-nitronaphthalene-1-sulfonate.
| Compound Name | sodium 3-hydroxy-7-nitronaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 2749239 |
| Molecular Formula | C10H6NNaO6S |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | sodium 3-hydroxy-7-nitronaphthalene-1-sulfonate |
| SMILES | O=[N+]([O-])c1ccc2cc(O)cc(S(=O)(=O)[O-])c2c1.[Na+] |
| InChI | InChI=1S/C10H7NO6S.Na/c12-8-3-6-1-2-7(11(13)14)4-9(6)10(5-8)18(15,16)17;/h1-5,12H,(H,15,16,17);/q;+1/p-1 |
| InChIKey | YVFKUTMSCNMIBE-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|