C13H13NaO3S — CID 23547332
sodium 4,5,7-trimethylnaphthalene-1-sulfonate (PubChem CID 23547332) has the molecular formula C13H13NaO3S and a molecular weight of 272.30 g/mol. Its IUPAC name is sodium 4,5,7-trimethylnaphthalene-1-sulfonate.
| Compound Name | sodium 4,5,7-trimethylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 23547332 |
| Molecular Formula | C13H13NaO3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | sodium 4,5,7-trimethylnaphthalene-1-sulfonate |
| SMILES | Cc1cc(C)c2c(C)ccc(S(=O)(=O)[O-])c2c1.[Na+] |
| InChI | InChI=1S/C13H14O3S.Na/c1-8-6-10(3)13-9(2)4-5-12(11(13)7-8)17(14,15)16;/h4-7H,1-3H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | MVCNFKONHJCVKX-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|