C41H38N8O9S4 — CID 10148143
4-amino-3-[[4-[4-[[1-[4,5-bis[(2-sulfanylacetyl)amino]pentanoylamino]-4-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 10148143) has the molecular formula C41H38N8O9S4 and a molecular weight of 915.07 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[[1-[4,5-bis[(2-sulfanylacetyl)amino]pentanoylamino]-4-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[[1-[4,5-bis[(2-sulfanylacetyl)amino]pentanoylamino]-4-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 10148143 |
| Molecular Formula | C41H38N8O9S4 |
| Molecular Weight | 915.07 g/mol |
| Exact Mass | 914.16 |
| IUPAC Name | 4-amino-3-[[4-[4-[[1-[4,5-bis[(2-sulfanylacetyl)amino]pentanoylamino]-4-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4cc(S(=O)(=O)O)c5ccccc5c4NC(=O)CCC(CNC(=O)CS)NC(=O)CS)cc3)cc2)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C41H38N8O9S4/c42-40-31-7-3-1-5-29(31)35(61(53,54)55)19-33(40)48-46-26-13-9-24(10-14-26)25-11-15-27(16-12-25)47-49-34-20-36(62(56,57)58)30-6-2-4-8-32(30)41(34)45-37(50)18-17-28(44-39(52)23-60)21-43-38(51)22-59/h1-16,19-20,28,59-60H,17-18,21-23,42H2,(H,43,51)(H,44,52)(H,45,50)(H,53,54,55)(H,56,57,58)/b48-46+,49-47+ |
| InChIKey | NPSDOOSAVNQPBB-ROHDNENLSA-N |
| XLogP | 7.75 |
| TPSA | 271.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.07 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|