C38H36N6O6S2 — CID 153382275
1-amino-4-[[4-[4-[(4-amino-3-sulfonaphthalen-1-yl)diazenyl]-3-propylphenyl]-2-propylphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 153382275) has the molecular formula C38H36N6O6S2 and a molecular weight of 736.88 g/mol. Its IUPAC name is 1-amino-4-[[4-[4-[(4-amino-3-sulfonaphthalen-1-yl)diazenyl]-3-propylphenyl]-2-propylphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 1-amino-4-[[4-[4-[(4-amino-3-sulfonaphthalen-1-yl)diazenyl]-3-propylphenyl]-2-propylphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 153382275 |
| Molecular Formula | C38H36N6O6S2 |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 736.21 |
| IUPAC Name | 1-amino-4-[[4-[4-[(4-amino-3-sulfonaphthalen-1-yl)diazenyl]-3-propylphenyl]-2-propylphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CCCc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c(N)c4ccccc34)c(CCC)c2)ccc1/N=N/c1cc(S(=O)(=O)O)c(N)c2ccccc12 |
| InChI | InChI=1S/C38H36N6O6S2/c1-3-9-25-19-23(15-17-31(25)41-43-33-21-35(51(45,46)47)37(39)29-13-7-5-11-27(29)33)24-16-18-32(26(20-24)10-4-2)42-44-34-22-36(52(48,49)50)38(40)30-14-8-6-12-28(30)34/h5-8,11-22H,3-4,9-10,39-40H2,1-2H3,(H,45,46,47)(H,48,49,50)/b43-41+,44-42+ |
| InChIKey | WYIYXLJCWKSCOP-CHQNLTHESA-N |
| XLogP | 10.05 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|