C34H26N4O9S2 — CID 136714850
3-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid (PubChem CID 136714850) has the molecular formula C34H26N4O9S2 and a molecular weight of 698.74 g/mol. Its IUPAC name is 3-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 3-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136714850 |
| Molecular Formula | C34H26N4O9S2 |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 698.11 |
| IUPAC Name | 3-[[4-[3-ethoxy-4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
| SMILES | CCOc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3O)cc2)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C34H26N4O9S2/c1-2-47-30-17-21(13-16-27(30)36-38-29-19-32(49(44,45)46)24-8-4-6-10-26(24)34(29)40)20-11-14-22(15-12-20)35-37-28-18-31(48(41,42)43)23-7-3-5-9-25(23)33(28)39/h3-19,39-40H,2H2,1H3,(H,41,42,43)(H,44,45,46)/b37-35+,38-36+ |
| InChIKey | RGOYCFOVLATTNU-ATXIYDNESA-N |
| XLogP | 8.79 |
| TPSA | 207.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|