C20H18N4O4S — CID 3019151
5-ethoxy-2-[(4-phenyldiazenylphenyl)diazenyl]benzenesulfonic acid (PubChem CID 3019151) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 5-ethoxy-2-[(4-phenyldiazenylphenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 5-ethoxy-2-[(4-phenyldiazenylphenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 3019151 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 5-ethoxy-2-[(4-phenyldiazenylphenyl)diazenyl]benzenesulfonic acid |
| SMILES | CCOc1ccc(/N=N/c2ccc(/N=N/c3ccccc3)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H18N4O4S/c1-2-28-18-12-13-19(20(14-18)29(25,26)27)24-23-17-10-8-16(9-11-17)22-21-15-6-4-3-5-7-15/h3-14H,2H2,1H3,(H,25,26,27)/b22-21+,24-23+ |
| InChIKey | WABCRLDBWCNFFW-RLPYSRNMSA-N |
| XLogP | 6.16 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|