C18H21BrN2O2 — CID 3360060
2-bromo-4-tert-butyl-6-[(4-ethoxyphenyl)diazenyl]phenol (PubChem CID 3360060) has the molecular formula C18H21BrN2O2 and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-bromo-4-tert-butyl-6-[(4-ethoxyphenyl)diazenyl]phenol.
| Compound Name | 2-bromo-4-tert-butyl-6-[(4-ethoxyphenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 3360060 |
| Molecular Formula | C18H21BrN2O2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-bromo-4-tert-butyl-6-[(4-ethoxyphenyl)diazenyl]phenol |
| SMILES | CCOc1ccc(/N=N/c2cc(C(C)(C)C)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C18H21BrN2O2/c1-5-23-14-8-6-13(7-9-14)20-21-16-11-12(18(2,3)4)10-15(19)17(16)22/h6-11,22H,5H2,1-4H3/b21-20+ |
| InChIKey | LQYXNYGWWDYIQI-QZQOTICOSA-N |
| XLogP | 6.27 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|