C12H17BrO — CID 12857381
2-bromo-4-tert-butyl-6-ethylphenol (PubChem CID 12857381) has the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. Its IUPAC name is 2-bromo-4-tert-butyl-6-ethylphenol.
| Compound Name | 2-bromo-4-tert-butyl-6-ethylphenol |
|---|---|
| PubChem CID | 12857381 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-bromo-4-tert-butyl-6-ethylphenol |
| SMILES | CCc1cc(C(C)(C)C)cc(Br)c1O |
| InChI | InChI=1S/C12H17BrO/c1-5-8-6-9(12(2,3)4)7-10(13)11(8)14/h6-7,14H,5H2,1-4H3 |
| InChIKey | KDTCGMFJDDLIBH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |