C28H26N4O10S2 — CID 137244001
5-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-[4-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]benzenesulfonic acid (PubChem CID 137244001) has the molecular formula C28H26N4O10S2 and a molecular weight of 642.67 g/mol. Its IUPAC name is 5-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-[4-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]benzenesulfonic acid.
| Compound Name | 5-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-[4-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 137244001 |
| Molecular Formula | C28H26N4O10S2 |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | 5-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-[4-[(3-ethoxy-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]benzenesulfonic acid |
| SMILES | CCOc1cc(/N=N/c2ccc(-c3ccc(/N=N/c4ccc(O)c(OCC)c4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)ccc1O |
| InChI | InChI=1S/C28H26N4O10S2/c1-3-41-25-13-17(7-11-23(25)33)29-31-19-5-9-21(27(15-19)43(35,36)37)22-10-6-20(16-28(22)44(38,39)40)32-30-18-8-12-24(34)26(14-18)42-4-2/h5-16,33-34H,3-4H2,1-2H3,(H,35,36,37)(H,38,39,40)/b31-29+,32-30+ |
| InChIKey | WFDLNTSHDITSBS-JWTBXLROSA-N |
| XLogP | 6.89 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|