C40H36N8O2 — CID 158444452
(4-ethoxy-3-methylphenyl)-(4-phenyldiazenylphenyl)diazene;2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenol (PubChem CID 158444452) has the molecular formula C40H36N8O2 and a molecular weight of 660.78 g/mol. Its IUPAC name is (4-ethoxy-3-methylphenyl)-(4-phenyldiazenylphenyl)diazene;2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenol.
| Compound Name | (4-ethoxy-3-methylphenyl)-(4-phenyldiazenylphenyl)diazene;2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 158444452 |
| Molecular Formula | C40H36N8O2 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | (4-ethoxy-3-methylphenyl)-(4-phenyldiazenylphenyl)diazene;2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenol |
| SMILES | CCOc1ccc(/N=N/c2ccc(/N=N/c3ccccc3)cc2)cc1C.Cc1cc(/N=N/c2ccc(/N=N/c3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C21H20N4O.C19H16N4O/c1-3-26-21-14-13-20(15-16(21)2)25-24-19-11-9-18(10-12-19)23-22-17-7-5-4-6-8-17;1-14-13-18(11-12-19(14)24)23-22-17-9-7-16(8-10-17)21-20-15-5-3-2-4-6-15/h4-15H,3H2,1-2H3;2-13,24H,1H3/b23-22+,25-24+;21-20+,23-22+ |
| InChIKey | HDFGJJKJXCKJKL-ZIFQKSGASA-N |
| XLogP | 13.76 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|