C13H13N3NaO3S+ — CID 54606161
sodium (4-phenyldiazenylanilino)methanesulfonic acid (PubChem CID 54606161) has the molecular formula C13H13N3NaO3S+ and a molecular weight of 314.32 g/mol. Its IUPAC name is sodium (4-phenyldiazenylanilino)methanesulfonic acid.
| Compound Name | sodium (4-phenyldiazenylanilino)methanesulfonic acid |
|---|---|
| PubChem CID | 54606161 |
| Molecular Formula | C13H13N3NaO3S+ |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | sodium (4-phenyldiazenylanilino)methanesulfonic acid |
| SMILES | O=S(=O)(O)CNc1ccc(/N=N/c2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C13H13N3O3S.Na/c17-20(18,19)10-14-11-6-8-13(9-7-11)16-15-12-4-2-1-3-5-12;/h1-9,14H,10H2,(H,17,18,19);/q;+1/b16-15+; |
| InChIKey | SZEINZOAMKDHLZ-GEEYTBSJSA-N |
| XLogP | 0.36 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|