C24H20N5O5S2- — CID 173494979
4-hydroxy-7-(methylsulfonylmethylamino)-1,3-bis(phenyldiazenyl)naphthalene-2-sulfinate (PubChem CID 173494979) has the molecular formula C24H20N5O5S2- and a molecular weight of 522.59 g/mol. Its IUPAC name is 4-hydroxy-7-(methylsulfonylmethylamino)-1,3-bis(phenyldiazenyl)naphthalene-2-sulfinate.
| Compound Name | 4-hydroxy-7-(methylsulfonylmethylamino)-1,3-bis(phenyldiazenyl)naphthalene-2-sulfinate |
|---|---|
| PubChem CID | 173494979 |
| Molecular Formula | C24H20N5O5S2- |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 4-hydroxy-7-(methylsulfonylmethylamino)-1,3-bis(phenyldiazenyl)naphthalene-2-sulfinate |
| SMILES | CS(=O)(=O)CNc1ccc2c(O)c(/N=N/c3ccccc3)c(S(=O)[O-])c(/N=N/c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H21N5O5S2/c1-36(33,34)15-25-18-12-13-19-20(14-18)21(28-26-16-8-4-2-5-9-16)24(35(31)32)22(23(19)30)29-27-17-10-6-3-7-11-17/h2-14,25,30H,15H2,1H3,(H,31,32)/p-1/b28-26+,29-27+ |
| InChIKey | QVOLUXFEBKHZIN-TUUFZWAFSA-M |
| XLogP | 6.03 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|