C16H13N3O4S — CID 135819077
7-amino-4-hydroxy-1-phenyldiazenylnaphthalene-2-sulfonic acid (PubChem CID 135819077) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is 7-amino-4-hydroxy-1-phenyldiazenylnaphthalene-2-sulfonic acid.
| Compound Name | 7-amino-4-hydroxy-1-phenyldiazenylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135819077 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 7-amino-4-hydroxy-1-phenyldiazenylnaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2c(O)cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c2c1 |
| InChI | InChI=1S/C16H13N3O4S/c17-10-6-7-12-13(8-10)16(15(9-14(12)20)24(21,22)23)19-18-11-4-2-1-3-5-11/h1-9,20H,17H2,(H,21,22,23)/b19-18+ |
| InChIKey | VPRLEXRSAZWTDB-VHEBQXMUSA-N |
| XLogP | 3.79 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|