C24H20MoN5O5S2- — CID 173494978
6-(methylsulfonylmethylamino)-2,4-bis(phenyldiazenyl)-3-sulfinatonaphthalen-1-ol;molybdenum (PubChem CID 173494978) has the molecular formula C24H20MoN5O5S2- and a molecular weight of 618.53 g/mol. Its IUPAC name is 6-(methylsulfonylmethylamino)-2,4-bis(phenyldiazenyl)-3-sulfinatonaphthalen-1-ol;molybdenum.
| Compound Name | 6-(methylsulfonylmethylamino)-2,4-bis(phenyldiazenyl)-3-sulfinatonaphthalen-1-ol;molybdenum |
|---|---|
| PubChem CID | 173494978 |
| Molecular Formula | C24H20MoN5O5S2- |
| Molecular Weight | 618.53 g/mol |
| Exact Mass | 620.00 |
| IUPAC Name | 6-(methylsulfonylmethylamino)-2,4-bis(phenyldiazenyl)-3-sulfinatonaphthalen-1-ol;molybdenum |
| SMILES | CS(=O)(=O)CNc1ccc2c(O)c(/N=N/c3ccccc3)c([S-](=O)=O)c(/N=N/c3ccccc3)c2c1.[Mo] |
| InChI | InChI=1S/C24H20N5O5S2.Mo/c1-36(33,34)15-25-18-12-13-19-20(14-18)21(28-26-16-8-4-2-5-9-16)24(35(31)32)22(23(19)30)29-27-17-10-6-3-7-11-17;/h2-14,25,30H,15H2,1H3;/q-1;/b28-26+,29-27+; |
| InChIKey | FKXMMTDQVFMWGO-JBQZZDHSSA-N |
| XLogP | 6.46 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|