C14H14N4O6S — CID 150250346
[3-(hydroxymethyl)-4-[(4-nitrophenyl)diazenyl]anilino]methanesulfonic acid (PubChem CID 150250346) has the molecular formula C14H14N4O6S and a molecular weight of 366.36 g/mol. Its IUPAC name is [3-(hydroxymethyl)-4-[(4-nitrophenyl)diazenyl]anilino]methanesulfonic acid.
| Compound Name | [3-(hydroxymethyl)-4-[(4-nitrophenyl)diazenyl]anilino]methanesulfonic acid |
|---|---|
| PubChem CID | 150250346 |
| Molecular Formula | C14H14N4O6S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [3-(hydroxymethyl)-4-[(4-nitrophenyl)diazenyl]anilino]methanesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc(NCS(=O)(=O)O)cc2CO)cc1 |
| InChI | InChI=1S/C14H14N4O6S/c19-8-10-7-12(15-9-25(22,23)24)3-6-14(10)17-16-11-1-4-13(5-2-11)18(20)21/h1-7,15,19H,8-9H2,(H,22,23,24)/b17-16+ |
| InChIKey | WDRMUCCPXAYCIW-WUKNDPDISA-N |
| XLogP | 2.76 |
| TPSA | 154.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|