C38H30N6O9S — CID 136632579
2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(phenoxyamino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid (PubChem CID 136632579) has the molecular formula C38H30N6O9S and a molecular weight of 746.76 g/mol. Its IUPAC name is 2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(phenoxyamino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid.
| Compound Name | 2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(phenoxyamino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 136632579 |
| Molecular Formula | C38H30N6O9S |
| Molecular Weight | 746.76 g/mol |
| Exact Mass | 746.18 |
| IUPAC Name | 2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(phenoxyamino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(C=Cc3ccc([N+](=O)[O-])cc3S(=O)(=O)O)cc2)c(CO)cc1/N=N/c1ccc2cc(NOc3ccccc3)ccc2c1O |
| InChI | InChI=1S/C38H30N6O9S/c1-52-36-22-34(41-39-28-13-8-24(9-14-28)7-10-25-11-16-30(44(47)48)21-37(25)54(49,50)51)27(23-45)20-35(36)42-40-33-18-12-26-19-29(15-17-32(26)38(33)46)43-53-31-5-3-2-4-6-31/h2-22,43,45-46H,23H2,1H3,(H,49,50,51)/b10-7?,41-39+,42-40+ |
| InChIKey | HQXCBUGSZVWTEZ-QKNWYXDMSA-N |
| XLogP | 9.61 |
| TPSA | 217.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.76 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|