C39H32N6O8S — CID 136632575
2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(4-methylanilino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid (PubChem CID 136632575) has the molecular formula C39H32N6O8S and a molecular weight of 744.79 g/mol. Its IUPAC name is 2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(4-methylanilino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid.
| Compound Name | 2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(4-methylanilino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 136632575 |
| Molecular Formula | C39H32N6O8S |
| Molecular Weight | 744.79 g/mol |
| Exact Mass | 744.20 |
| IUPAC Name | 2-[2-[4-[[2-(hydroxymethyl)-4-[[1-hydroxy-6-(4-methylanilino)naphthalen-2-yl]diazenyl]-5-methoxyphenyl]diazenyl]phenyl]ethenyl]-5-nitrobenzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(C=Cc3ccc([N+](=O)[O-])cc3S(=O)(=O)O)cc2)c(CO)cc1/N=N/c1ccc2cc(Nc3ccc(C)cc3)ccc2c1O |
| InChI | InChI=1S/C39H32N6O8S/c1-24-3-11-29(12-4-24)40-31-15-17-33-27(19-31)10-18-34(39(33)47)42-44-36-20-28(23-46)35(22-37(36)53-2)43-41-30-13-6-25(7-14-30)5-8-26-9-16-32(45(48)49)21-38(26)54(50,51)52/h3-22,40,46-47H,23H2,1-2H3,(H,50,51,52)/b8-5?,43-41+,44-42+ |
| InChIKey | UUXPPZXINAWWEE-HLAKVLKRSA-N |
| XLogP | 10.25 |
| TPSA | 208.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.79 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|