C20H16N4O3S — CID 148653145
8-amino-5-[(4-aminonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 148653145) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 8-amino-5-[(4-aminonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 8-amino-5-[(4-aminonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 148653145 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 8-amino-5-[(4-aminonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(N)c3c(S(=O)(=O)O)cccc23)c2ccccc12 |
| InChI | InChI=1S/C20H16N4O3S/c21-15-8-10-17(13-5-2-1-4-12(13)15)23-24-18-11-9-16(22)20-14(18)6-3-7-19(20)28(25,26)27/h1-11H,21-22H2,(H,25,26,27)/b24-23+ |
| InChIKey | NMHNFTJWRRKRFM-WCWDXBQESA-N |
| XLogP | 4.82 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|