C27H20N4O6S2 — CID 122680887
8-methyl-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 122680887) has the molecular formula C27H20N4O6S2 and a molecular weight of 560.61 g/mol. Its IUPAC name is 8-methyl-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 8-methyl-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 122680887 |
| Molecular Formula | C27H20N4O6S2 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | 8-methyl-5-[[4-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3ccccc3S(=O)(=O)O)c3ccccc23)c2cccc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C27H20N4O6S2/c1-17-13-14-23(20-9-6-12-26(27(17)20)39(35,36)37)30-28-21-15-16-22(19-8-3-2-7-18(19)21)29-31-24-10-4-5-11-25(24)38(32,33)34/h2-16H,1H3,(H,32,33,34)(H,35,36,37)/b30-28+,31-29+ |
| InChIKey | KINPHTAUTYMAAV-FUEWEDNTSA-N |
| XLogP | 7.63 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|