C25H22N4O9S3 — CID 89165069
2-[[2,5-dimethyl-4-[(4-methyl-5-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid (PubChem CID 89165069) has the molecular formula C25H22N4O9S3 and a molecular weight of 618.67 g/mol. Its IUPAC name is 2-[[2,5-dimethyl-4-[(4-methyl-5-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[2,5-dimethyl-4-[(4-methyl-5-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 89165069 |
| Molecular Formula | C25H22N4O9S3 |
| Molecular Weight | 618.67 g/mol |
| Exact Mass | 618.05 |
| IUPAC Name | 2-[[2,5-dimethyl-4-[(4-methyl-5-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid |
| SMILES | Cc1cc(/N=N/c2ccc(C)c3c(S(=O)(=O)O)cccc23)c(C)cc1/N=N/c1cc(S(=O)(=O)O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C25H22N4O9S3/c1-14-7-9-19(18-5-4-6-24(25(14)18)41(36,37)38)26-27-20-11-16(3)21(12-15(20)2)28-29-22-13-17(39(30,31)32)8-10-23(22)40(33,34)35/h4-13H,1-3H3,(H,30,31,32)(H,33,34,35)(H,36,37,38)/b27-26+,29-28+ |
| InChIKey | BXWTTWCQUMBXMM-ZDXBJJIESA-N |
| XLogP | 6.34 |
| TPSA | 212.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|