C10H8ClNO3S — CID 130155184
4-amino-5-chloronaphthalene-1-sulfonic acid (PubChem CID 130155184) has the molecular formula C10H8ClNO3S and a molecular weight of 257.70 g/mol. Its IUPAC name is 4-amino-5-chloronaphthalene-1-sulfonic acid.
| Compound Name | 4-amino-5-chloronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 130155184 |
| Molecular Formula | C10H8ClNO3S |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 4-amino-5-chloronaphthalene-1-sulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)c2cccc(Cl)c12 |
| InChI | InChI=1S/C10H8ClNO3S/c11-7-3-1-2-6-9(16(13,14)15)5-4-8(12)10(6)7/h1-5H,12H2,(H,13,14,15) |
| InChIKey | VEJHEJBGLHBWEO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|