C16H13N3O4S2 — CID 136704038
8-hydroxy-7-[(2-methylsulfanylphenyl)diazenyl]quinoline-5-sulfonic acid (PubChem CID 136704038) has the molecular formula C16H13N3O4S2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 8-hydroxy-7-[(2-methylsulfanylphenyl)diazenyl]quinoline-5-sulfonic acid.
| Compound Name | 8-hydroxy-7-[(2-methylsulfanylphenyl)diazenyl]quinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 136704038 |
| Molecular Formula | C16H13N3O4S2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 8-hydroxy-7-[(2-methylsulfanylphenyl)diazenyl]quinoline-5-sulfonic acid |
| SMILES | CSc1ccccc1/N=N/c1cc(S(=O)(=O)O)c2cccnc2c1O |
| InChI | InChI=1S/C16H13N3O4S2/c1-24-13-7-3-2-6-11(13)18-19-12-9-14(25(21,22)23)10-5-4-8-17-15(10)16(12)20/h2-9,20H,1H3,(H,21,22,23)/b19-18+ |
| InChIKey | XNHBQVSZNBINMH-VHEBQXMUSA-N |
| XLogP | 4.32 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|