C32H24N6NaO14S4 — CID 135788850
CID 135788850 (PubChem CID 135788850) has the molecular formula C32H24N6NaO14S4 and a molecular weight of 867.83 g/mol.
| Compound Name | CID 135788850 |
|---|---|
| PubChem CID | 135788850 |
| Molecular Formula | C32H24N6NaO14S4 |
| Molecular Weight | 867.83 g/mol |
| Exact Mass | 867.01 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2cc(S(=O)(=O)O)c3cccnc3c2O)ccc1CCc1ccc(/N=N/c2cc(S(=O)(=O)O)c3cccnc3c2O)cc1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C32H24N6O14S4.Na/c39-31-23(15-27(55(47,48)49)21-3-1-11-33-29(21)31)37-35-19-9-7-17(25(13-19)53(41,42)43)5-6-18-8-10-20(14-26(18)54(44,45)46)36-38-24-16-28(56(50,51)52)22-4-2-12-34-30(22)32(24)40;/h1-4,7-16,39-40H,5-6H2,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52);/b37-35+,38-36+; |
| InChIKey | CFONZIIFUXJZKS-DZPQVTRNSA-N |
| XLogP | 5.42 |
| TPSA | 333.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|