C15H6F5N3O4S — CID 135974849
8-hydroxy-7-[(2,3,4,5,6-pentafluorophenyl)diazenyl]quinoline-5-sulfonic acid (PubChem CID 135974849) has the molecular formula C15H6F5N3O4S and a molecular weight of 419.29 g/mol. Its IUPAC name is 8-hydroxy-7-[(2,3,4,5,6-pentafluorophenyl)diazenyl]quinoline-5-sulfonic acid.
| Compound Name | 8-hydroxy-7-[(2,3,4,5,6-pentafluorophenyl)diazenyl]quinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 135974849 |
| Molecular Formula | C15H6F5N3O4S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 8-hydroxy-7-[(2,3,4,5,6-pentafluorophenyl)diazenyl]quinoline-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2c(F)c(F)c(F)c(F)c2F)c(O)c2ncccc12 |
| InChI | InChI=1S/C15H6F5N3O4S/c16-8-9(17)11(19)14(12(20)10(8)18)23-22-6-4-7(28(25,26)27)5-2-1-3-21-13(5)15(6)24/h1-4,24H,(H,25,26,27)/b23-22+ |
| InChIKey | CKASPZXDDJMWLT-GHVJWSGMSA-N |
| XLogP | 4.30 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|