C34H24N4O14S4 — CID 135499365
8-hydroxy-7-[[4-[(Z)-2-[4-[(8-hydroxy-5-sulfoquinolin-7-yl)methylideneamino]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminomethyl]quinoline-5-sulfonic acid (PubChem CID 135499365) has the molecular formula C34H24N4O14S4 and a molecular weight of 840.85 g/mol. Its IUPAC name is 8-hydroxy-7-[[4-[(Z)-2-[4-[(8-hydroxy-5-sulfoquinolin-7-yl)methylideneamino]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminomethyl]quinoline-5-sulfonic acid.
| Compound Name | 8-hydroxy-7-[[4-[(Z)-2-[4-[(8-hydroxy-5-sulfoquinolin-7-yl)methylideneamino]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminomethyl]quinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 135499365 |
| Molecular Formula | C34H24N4O14S4 |
| Molecular Weight | 840.85 g/mol |
| Exact Mass | 840.02 |
| IUPAC Name | 8-hydroxy-7-[[4-[(Z)-2-[4-[(8-hydroxy-5-sulfoquinolin-7-yl)methylideneamino]-2-sulfophenyl]ethenyl]-3-sulfophenyl]iminomethyl]quinoline-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(/N=C/c2cc(S(=O)(=O)O)c3cccnc3c2O)ccc1/C=C\c1ccc(/N=C/c2cc(S(=O)(=O)O)c3cccnc3c2O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C34H24N4O14S4/c39-33-21(13-29(55(47,48)49)25-3-1-11-35-31(25)33)17-37-23-9-7-19(27(15-23)53(41,42)43)5-6-20-8-10-24(16-28(20)54(44,45)46)38-18-22-14-30(56(50,51)52)26-4-2-12-36-32(26)34(22)40/h1-18,39-40H,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52)/b6-5-,37-17+,38-18+ |
| InChIKey | LSKHLQXLKJCJPW-JMLYECICSA-N |
| XLogP | 4.85 |
| TPSA | 308.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|