C19H12N3O6S2- — CID 137142938
5-[(8-hydroxy-5-sulfoquinolin-7-yl)diazenyl]naphthalene-1-sulfinate (PubChem CID 137142938) has the molecular formula C19H12N3O6S2- and a molecular weight of 442.45 g/mol. Its IUPAC name is 5-[(8-hydroxy-5-sulfoquinolin-7-yl)diazenyl]naphthalene-1-sulfinate.
| Compound Name | 5-[(8-hydroxy-5-sulfoquinolin-7-yl)diazenyl]naphthalene-1-sulfinate |
|---|---|
| PubChem CID | 137142938 |
| Molecular Formula | C19H12N3O6S2- |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 5-[(8-hydroxy-5-sulfoquinolin-7-yl)diazenyl]naphthalene-1-sulfinate |
| SMILES | O=S([O-])c1cccc2c(/N=N/c3cc(S(=O)(=O)O)c4cccnc4c3O)cccc12 |
| InChI | InChI=1S/C19H13N3O6S2/c23-19-15(10-17(30(26,27)28)13-6-3-9-20-18(13)19)22-21-14-7-1-5-12-11(14)4-2-8-16(12)29(24)25/h1-10,23H,(H,24,25)(H,26,27,28)/p-1/b22-21+ |
| InChIKey | INXGSWAULPYMOE-QURGRASLSA-M |
| XLogP | 3.99 |
| TPSA | 152.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|