C25H15N7O4S — CID 135974886
8-hydroxy-7-[[5-[(4-isocyanophenyl)diazenyl]quinolin-8-yl]diazenyl]quinoline-5-sulfonic acid (PubChem CID 135974886) has the molecular formula C25H15N7O4S and a molecular weight of 509.51 g/mol. Its IUPAC name is 8-hydroxy-7-[[5-[(4-isocyanophenyl)diazenyl]quinolin-8-yl]diazenyl]quinoline-5-sulfonic acid.
| Compound Name | 8-hydroxy-7-[[5-[(4-isocyanophenyl)diazenyl]quinolin-8-yl]diazenyl]quinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 135974886 |
| Molecular Formula | C25H15N7O4S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 8-hydroxy-7-[[5-[(4-isocyanophenyl)diazenyl]quinolin-8-yl]diazenyl]quinoline-5-sulfonic acid |
| SMILES | [C-]#[N+]c1ccc(/N=N/c2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccnc4c3O)c3ncccc23)cc1 |
| InChI | InChI=1S/C25H15N7O4S/c1-26-15-6-8-16(9-7-15)29-30-19-10-11-20(23-17(19)4-2-12-27-23)31-32-21-14-22(37(34,35)36)18-5-3-13-28-24(18)25(21)33/h2-14,33H,(H,34,35,36)/b30-29+,32-31+ |
| InChIKey | MDLCETQOKAGOAM-PNBBGTCESA-N |
| XLogP | 7.12 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|