C14H8Cl2N4O4S — CID 136823052
7-[(3,5-dichloro-2-pyridinyl)diazenyl]-8-hydroxyquinoline-5-sulfonic acid (PubChem CID 136823052) has the molecular formula C14H8Cl2N4O4S and a molecular weight of 399.22 g/mol. Its IUPAC name is 7-[(3,5-dichloro-2-pyridinyl)diazenyl]-8-hydroxyquinoline-5-sulfonic acid.
| Compound Name | 7-[(3,5-dichloro-2-pyridinyl)diazenyl]-8-hydroxyquinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 136823052 |
| Molecular Formula | C14H8Cl2N4O4S |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | 7-[(3,5-dichloro-2-pyridinyl)diazenyl]-8-hydroxyquinoline-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2ncc(Cl)cc2Cl)c(O)c2ncccc12 |
| InChI | InChI=1S/C14H8Cl2N4O4S/c15-7-4-9(16)14(18-6-7)20-19-10-5-11(25(22,23)24)8-2-1-3-17-12(8)13(10)21/h1-6,21H,(H,22,23,24)/b20-19+ |
| InChIKey | PQXBCCTVTTULOR-FMQUCBEESA-N |
| XLogP | 4.30 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|