C16H10ClN3O7S — CID 135727413
3-[(5-chloro-2-hydroxy-3-nitrophenyl)diazenyl]-4-hydroxynaphthalene-1-sulfonic acid (PubChem CID 135727413) has the molecular formula C16H10ClN3O7S and a molecular weight of 423.79 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxy-3-nitrophenyl)diazenyl]-4-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 3-[(5-chloro-2-hydroxy-3-nitrophenyl)diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135727413 |
| Molecular Formula | C16H10ClN3O7S |
| Molecular Weight | 423.79 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 3-[(5-chloro-2-hydroxy-3-nitrophenyl)diazenyl]-4-hydroxynaphthalene-1-sulfonic acid |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(/N=N/c2cc(S(=O)(=O)O)c3ccccc3c2O)c1O |
| InChI | InChI=1S/C16H10ClN3O7S/c17-8-5-11(16(22)13(6-8)20(23)24)18-19-12-7-14(28(25,26)27)9-3-1-2-4-10(9)15(12)21/h1-7,21-22H,(H,25,26,27)/b19-18+ |
| InChIKey | OQWPXRUFGBVRDD-VHEBQXMUSA-N |
| XLogP | 4.47 |
| TPSA | 162.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|