C13H11N5O4S2 — CID 135794649
4-hydroxy-3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 135794649) has the molecular formula C13H11N5O4S2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 4-hydroxy-3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-hydroxy-3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135794649 |
| Molecular Formula | C13H11N5O4S2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 4-hydroxy-3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | CSc1n[nH]c(/N=N/c2cc(S(=O)(=O)O)c3ccccc3c2O)n1 |
| InChI | InChI=1S/C13H11N5O4S2/c1-23-13-14-12(17-18-13)16-15-9-6-10(24(20,21)22)7-4-2-3-5-8(7)11(9)19/h2-6,19H,1H3,(H,14,17,18)(H,20,21,22)/b16-15+ |
| InChIKey | UJKRSEACTJMBHZ-FOCLMDBBSA-N |
| XLogP | 3.05 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|