C34H24N6O8S2 — CID 136775210
6-hydroxy-2-[3-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]-7-[(2-methylphenyl)diazenyl]-1H-benzo[e]benzimidazole-8-sulfonic acid (PubChem CID 136775210) has the molecular formula C34H24N6O8S2 and a molecular weight of 708.73 g/mol. Its IUPAC name is 6-hydroxy-2-[3-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]-7-[(2-methylphenyl)diazenyl]-1H-benzo[e]benzimidazole-8-sulfonic acid.
| Compound Name | 6-hydroxy-2-[3-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]-7-[(2-methylphenyl)diazenyl]-1H-benzo[e]benzimidazole-8-sulfonic acid |
|---|---|
| PubChem CID | 136775210 |
| Molecular Formula | C34H24N6O8S2 |
| Molecular Weight | 708.73 g/mol |
| Exact Mass | 708.11 |
| IUPAC Name | 6-hydroxy-2-[3-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenyl]-7-[(2-methylphenyl)diazenyl]-1H-benzo[e]benzimidazole-8-sulfonic acid |
| SMILES | Cc1ccccc1/N=N/c1c(S(=O)(=O)O)cc2c(ccc3nc(-c4cccc(/N=N/c5cc(S(=O)(=O)O)c6ccccc6c5O)c4)[nH]c32)c1O |
| InChI | InChI=1S/C34H24N6O8S2/c1-18-7-2-5-12-25(18)38-40-31-29(50(46,47)48)16-24-23(33(31)42)13-14-26-30(24)36-34(35-26)19-8-6-9-20(15-19)37-39-27-17-28(49(43,44)45)21-10-3-4-11-22(21)32(27)41/h2-17,41-42H,1H3,(H,35,36)(H,43,44,45)(H,46,47,48)/b39-37+,40-38+ |
| InChIKey | YATNMQKQXWGXJH-HVMBLDELSA-N |
| XLogP | 8.58 |
| TPSA | 227.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.73 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|