C33H27N7O13S3 — CID 136620690
6-hydroxy-7-[[5-methyl-4-[(4-nitro-2-sulfophenyl)diazenyl]-2-(3-sulfopropoxy)phenyl]diazenyl]-2-phenyl-1H-benzo[e]benzimidazole-8-sulfonic acid (PubChem CID 136620690) has the molecular formula C33H27N7O13S3 and a molecular weight of 825.82 g/mol. Its IUPAC name is 6-hydroxy-7-[[5-methyl-4-[(4-nitro-2-sulfophenyl)diazenyl]-2-(3-sulfopropoxy)phenyl]diazenyl]-2-phenyl-1H-benzo[e]benzimidazole-8-sulfonic acid.
| Compound Name | 6-hydroxy-7-[[5-methyl-4-[(4-nitro-2-sulfophenyl)diazenyl]-2-(3-sulfopropoxy)phenyl]diazenyl]-2-phenyl-1H-benzo[e]benzimidazole-8-sulfonic acid |
|---|---|
| PubChem CID | 136620690 |
| Molecular Formula | C33H27N7O13S3 |
| Molecular Weight | 825.82 g/mol |
| Exact Mass | 825.08 |
| IUPAC Name | 6-hydroxy-7-[[5-methyl-4-[(4-nitro-2-sulfophenyl)diazenyl]-2-(3-sulfopropoxy)phenyl]diazenyl]-2-phenyl-1H-benzo[e]benzimidazole-8-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(S(=O)(=O)O)cc3c(ccc4nc(-c5ccccc5)[nH]c43)c2O)c(OCCCS(=O)(=O)O)cc1/N=N/c1ccc([N+](=O)[O-])cc1S(=O)(=O)O |
| InChI | InChI=1S/C33H27N7O13S3/c1-18-14-26(27(53-12-5-13-54(44,45)46)17-25(18)37-36-23-10-8-20(40(42)43)15-28(23)55(47,48)49)38-39-31-29(56(50,51)52)16-22-21(32(31)41)9-11-24-30(22)35-33(34-24)19-6-3-2-4-7-19/h2-4,6-11,14-17,41H,5,12-13H2,1H3,(H,34,35)(H,44,45,46)(H,47,48,49)(H,50,51,52)/b37-36+,39-38+ |
| InChIKey | RNXZBEOGXCHDHZ-DVQJGIKISA-N |
| XLogP | 7.29 |
| TPSA | 313.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.82 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|