C23H18N3O6PS — CID 136784500
4-hydroxy-3-[(10-hydroxy-5-methyl-10-oxophenophosphazinin-2-yl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 136784500) has the molecular formula C23H18N3O6PS and a molecular weight of 495.45 g/mol. Its IUPAC name is 4-hydroxy-3-[(10-hydroxy-5-methyl-10-oxophenophosphazinin-2-yl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-hydroxy-3-[(10-hydroxy-5-methyl-10-oxophenophosphazinin-2-yl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136784500 |
| Molecular Formula | C23H18N3O6PS |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 4-hydroxy-3-[(10-hydroxy-5-methyl-10-oxophenophosphazinin-2-yl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | CN1c2ccccc2P(=O)(O)c2cc(/N=N/c3cc(S(=O)(=O)O)c4ccccc4c3O)ccc21 |
| InChI | InChI=1S/C23H18N3O6PS/c1-26-18-8-4-5-9-20(18)33(28,29)21-12-14(10-11-19(21)26)24-25-17-13-22(34(30,31)32)15-6-2-3-7-16(15)23(17)27/h2-13,27H,1H3,(H,28,29)(H,30,31,32)/b25-24+ |
| InChIKey | JOLHLORCWZECCE-OCOZRVBESA-N |
| XLogP | 4.51 |
| TPSA | 139.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|