C19H18N2O4S — CID 135600701
4-[(4-hydroxy-3-propan-2-ylphenyl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 135600701) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-propan-2-ylphenyl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-[(4-hydroxy-3-propan-2-ylphenyl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135600701 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-[(4-hydroxy-3-propan-2-ylphenyl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | CC(C)c1cc(/N=N/c2ccc(S(=O)(=O)O)c3ccccc23)ccc1O |
| InChI | InChI=1S/C19H18N2O4S/c1-12(2)16-11-13(7-9-18(16)22)20-21-17-8-10-19(26(23,24)25)15-6-4-3-5-14(15)17/h3-12,22H,1-2H3,(H,23,24,25)/b21-20+ |
| InChIKey | GJVROPWYESHVLA-QZQOTICOSA-N |
| XLogP | 5.33 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|