C24H14N2O3 — CID 136661095
2-[(4-hydroxynaphthalen-1-yl)diazenyl]anthracene-9,10-dione (PubChem CID 136661095) has the molecular formula C24H14N2O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 2-[(4-hydroxynaphthalen-1-yl)diazenyl]anthracene-9,10-dione.
| Compound Name | 2-[(4-hydroxynaphthalen-1-yl)diazenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 136661095 |
| Molecular Formula | C24H14N2O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-[(4-hydroxynaphthalen-1-yl)diazenyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(/N=N/c3ccc(O)c4ccccc34)ccc21 |
| InChI | InChI=1S/C24H14N2O3/c27-22-12-11-21(15-5-1-2-6-16(15)22)26-25-14-9-10-19-20(13-14)24(29)18-8-4-3-7-17(18)23(19)28/h1-13,27H/b26-25+ |
| InChIKey | QYOQJFPXLAIICN-OCEACIFDSA-N |
| XLogP | 5.74 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|