C18H15N3O12S3 — CID 135748491
4-hydroxy-3-[[2-nitro-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 135748491) has the molecular formula C18H15N3O12S3 and a molecular weight of 561.53 g/mol. Its IUPAC name is 4-hydroxy-3-[[2-nitro-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-hydroxy-3-[[2-nitro-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135748491 |
| Molecular Formula | C18H15N3O12S3 |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | 4-hydroxy-3-[[2-nitro-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)CCOS(=O)(=O)O)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C18H15N3O12S3/c22-18-13-4-2-1-3-12(13)17(35(27,28)29)10-15(18)20-19-14-6-5-11(9-16(14)21(23)24)34(25,26)8-7-33-36(30,31)32/h1-6,9-10,22H,7-8H2,(H,27,28,29)(H,30,31,32)/b20-19+ |
| InChIKey | SXUVLJKTMJKJIC-FMQUCBEESA-N |
| XLogP | 2.71 |
| TPSA | 240.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|