C15H11N3NaO4S — CID 170841185
CID 170841185 (PubChem CID 170841185) has the molecular formula C15H11N3NaO4S and a molecular weight of 352.33 g/mol.
| Compound Name | CID 170841185 |
|---|---|
| PubChem CID | 170841185 |
| Molecular Formula | C15H11N3NaO4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cccc(/N=N/c2ccc3cccnc3c2O)c1.[Na] |
| InChI | InChI=1S/C15H11N3O4S.Na/c19-15-13(7-6-10-3-2-8-16-14(10)15)18-17-11-4-1-5-12(9-11)23(20,21)22;/h1-9,19H,(H,20,21,22);/b18-17+; |
| InChIKey | NWAWTENVURBWAW-ZAGWXBKKSA-N |
| XLogP | 3.22 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|