C21H20N2O5S — CID 136835651
2-[[3-[2-(1,3-dioxolan-2-yl)ethylsulfonyl]phenyl]diazenyl]naphthalen-1-ol (PubChem CID 136835651) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[[3-[2-(1,3-dioxolan-2-yl)ethylsulfonyl]phenyl]diazenyl]naphthalen-1-ol.
| Compound Name | 2-[[3-[2-(1,3-dioxolan-2-yl)ethylsulfonyl]phenyl]diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 136835651 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-[[3-[2-(1,3-dioxolan-2-yl)ethylsulfonyl]phenyl]diazenyl]naphthalen-1-ol |
| SMILES | O=S(=O)(CCC1OCCO1)c1cccc(/N=N/c2ccc3ccccc3c2O)c1 |
| InChI | InChI=1S/C21H20N2O5S/c24-21-18-7-2-1-4-15(18)8-9-19(21)23-22-16-5-3-6-17(14-16)29(25,26)13-10-20-27-11-12-28-20/h1-9,14,20,24H,10-13H2/b23-22+ |
| InChIKey | OLZAIELYKUSANK-GHVJWSGMSA-N |
| XLogP | 4.50 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|