C46H31N7O8S2 — CID 140963073
8-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[(5-hydroxynaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 140963073) has the molecular formula C46H31N7O8S2 and a molecular weight of 873.93 g/mol. Its IUPAC name is 8-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[(5-hydroxynaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 8-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[(5-hydroxynaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 140963073 |
| Molecular Formula | C46H31N7O8S2 |
| Molecular Weight | 873.93 g/mol |
| Exact Mass | 873.17 |
| IUPAC Name | 8-[[4-[(6-anilino-1-hydroxynaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-5-[(5-hydroxynaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3ccc(/N=N/c4ccc5c(O)cccc5c4)c4ccc(S(=O)(=O)O)cc34)ccc(/N=N/c3ccc4cc(Nc5ccccc5)ccc4c3O)c2c1 |
| InChI | InChI=1S/C46H31N7O8S2/c54-45-8-4-5-27-24-31(11-14-34(27)45)48-49-40-19-21-42(38-25-32(62(56,57)58)12-16-36(38)40)51-50-41-20-22-43(39-26-33(63(59,60)61)13-17-37(39)41)52-53-44-18-9-28-23-30(10-15-35(28)46(44)55)47-29-6-2-1-3-7-29/h1-26,47,54-55H,(H,56,57,58)(H,59,60,61)/b49-48+,51-50+,53-52+ |
| InChIKey | AVEDKMUAEWATJL-BHJNILFUSA-N |
| XLogP | 13.19 |
| TPSA | 235.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.93 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|